2362-64-3 4-Methoxythiobenzamide
Nama produk |
4-Methoxythiobenzamide |
Nama bahasa Inggris |
4-Methoxythiobenzamide;Benzenecarbothioamide, 4-methoxy-; Thio-p-anisamide; 4-methoxybenzenecarbothioamide |
MF |
C8H9NOS |
Berat Molekul |
167.2282 |
InChI |
InChI=1/C8H9NOS/c1-10-7-4-2-6(3-5-7)8(9)11/h2-5H,1H3,(H2,9,11) |
CAS NO |
2362-64-3 |
Struktur Molekul |
|
Kepadatan |
1.194g/cm3 |
Titik didih |
288.5°C at 760 mmHg |
Indeks bias |
1.619 |
Titik nyala |
128.3°C |
Tekanan uap |
0.00233mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R20/22:Harmful by inhalation and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|