ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
Nama produk |
Bis-(4-chlorophenylthio)methane |
Nama bahasa Inggris |
Bis-(4-chlorophenylthio)methane; Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
MF |
C13H10Cl2S2 |
Berat Molekul |
301.2545 |
InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
CAS NO |
2393-97-7 |
Struktur Molekul |
|
Kepadatan |
1.38g/cm3 |
Titik lebur |
45-48℃ |
Titik didih |
420.9°C at 760 mmHg |
Indeks bias |
1.677 |
Titik nyala |
192.5°C |
Tekanan uap |
6.64E-07mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|