2396-84-1 ethyl sorbate
Nama produk |
ethyl sorbate |
Nama bahasa Inggris |
ethyl sorbate; Ethyl 2,4-hexadienoate~Sorbic acid ethyl ester; (E,E)-2,4-Hexadienoic acid ethylester; Ethyl trans,trans-2,4-hexadienoate; ethyl hexa-2,4-dienoate; ethyl (2E,4E)-hexa-2,4-dienoate; ethyl (2Z,4Z)-hexa-2,4-dienoate |
MF |
C8H12O2 |
Berat Molekul |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3,5-7H,4H2,1-2H3/b5-3-,7-6- |
CAS NO |
2396-84-1 |
EINECS |
219-258-2 |
Struktur Molekul |
|
Kepadatan |
0.926g/cm3 |
Titik didih |
195.5°C at 760 mmHg |
Indeks bias |
1.454 |
Titik nyala |
69.4°C |
Tekanan uap |
0.418mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|