ChemNet > CAS > 25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
Nama produk |
1,3-dimethyl-1H-pyrazole-5-carbaldehyde |
Nama bahasa Inggris |
1,3-dimethyl-1H-pyrazole-5-carbaldehyde; 1,3-Dimethylpyrazole-5-carbaldehyde; 2,5-dimethylpyrazole-3-carbaldehyde |
MF |
C6H8N2O |
Berat Molekul |
124.1405 |
InChI |
InChI=1/C6H8N2O/c1-5-3-6(4-9)8(2)7-5/h3-4H,1-2H3 |
CAS NO |
25016-09-5 |
Struktur Molekul |
|
Kepadatan |
1.114g/cm3 |
Titik lebur |
40℃ |
Titik didih |
227.739°C at 760 mmHg |
Indeks bias |
1.543 |
Titik nyala |
91.534°C |
Tekanan uap |
0.076mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|