ChemNet > CAS > 25115-74-6 4-Cyano-4-phenylcyclohexanone
25115-74-6 4-Cyano-4-phenylcyclohexanone
| Nama produk |
4-Cyano-4-phenylcyclohexanone |
| Nama bahasa Inggris |
4-Cyano-4-phenylcyclohexanone; 4-oxo-1-phenylcyclohexanenitrile; 4-oxo-1-phenylcyclohexanecarbonitrile |
| MF |
C13H13NO |
| Berat Molekul |
199.2484 |
| InChI |
InChI=1/C13H13NO/c14-10-13(8-6-12(15)7-9-13)11-4-2-1-3-5-11/h1-5H,6-9H2 |
| CAS NO |
25115-74-6 |
| EINECS |
246-631-7 |
| Struktur Molekul |
|
| Kepadatan |
1.12g/cm3 |
| Titik lebur |
114-119℃ |
| Titik didih |
378.6°C at 760 mmHg |
| Indeks bias |
1.557 |
| Titik nyala |
182.8°C |
| Tekanan uap |
6.22E-06mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
