260-94-6 Acridine
Nama produk |
Acridine |
Nama bahasa Inggris |
Acridine; Dibenzo[b,e]pyridine |
MF |
C13H9N |
Berat Molekul |
179.2173 |
InChI |
InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
CAS NO |
260-94-6 |
EINECS |
205-971-6 |
Struktur Molekul |
|
Kepadatan |
1.187g/cm3 |
Titik lebur |
105-110℃ |
Titik didih |
346.7°C at 760 mmHg |
Indeks bias |
1.726 |
Titik nyala |
153.8°C |
Tekanan uap |
0.000113mmHg at 25°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|