ChemNet > CAS > 261762-39-4 2-Chloro-3,6-difluorobenzaldehyde
261762-39-4 2-Chloro-3,6-difluorobenzaldehyde
| Nama produk |
2-Chloro-3,6-difluorobenzaldehyde |
| Nama bahasa Inggris |
2-Chloro-3,6-difluorobenzaldehyde; |
| MF |
C7H3ClF2O |
| Berat Molekul |
176.5479 |
| InChI |
InChI=1/C7H3ClF2O/c8-7-4(3-11)5(9)1-2-6(7)10/h1-3H |
| CAS NO |
261762-39-4 |
| Struktur Molekul |
|
| Kepadatan |
1.453g/cm3 |
| Titik lebur |
46-50℃ |
| Titik didih |
206.4°C at 760 mmHg |
| Indeks bias |
1.536 |
| Titik nyala |
78.6°C |
| Tekanan uap |
0.238mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
