ChemNet > CAS > 261763-37-5 2,3-Difluoro-4-methylbenzoic acid
261763-37-5 2,3-Difluoro-4-methylbenzoic acid
Nama produk |
2,3-Difluoro-4-methylbenzoic acid |
Nama bahasa Inggris |
2,3-Difluoro-4-methylbenzoic acid; 2,3-Difluoro-p-toluic acid |
MF |
C8H6F2O2 |
Berat Molekul |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,1H3,(H,11,12) |
CAS NO |
261763-37-5 |
Struktur Molekul |
|
Kepadatan |
1.359g/cm3 |
Titik didih |
274°C at 760 mmHg |
Indeks bias |
1.511 |
Titik nyala |
119.5°C |
Tekanan uap |
0.0027mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|