ChemNet > CAS > 26351-19-9 Violuric acid monohydrate
26351-19-9 Violuric acid monohydrate
Nama produk |
Violuric acid monohydrate |
Nama bahasa Inggris |
Violuric acid monohydrate; Alloxan-5-oxime monohydrate; 5-Isonitrosobarbituric acid monohydrate; 5-(hydroxyimino)pyrimidine-2,4,6(1H,3H,5H)-trione hydrate (1:1) |
MF |
C4H5N3O5 |
Berat Molekul |
175.0996 |
InChI |
InChI=1/C4H3N3O4.H2O/c8-2-1(7-11)3(9)6-4(10)5-2;/h11H,(H2,5,6,8,9,10);1H2 |
CAS NO |
26351-19-9 |
EINECS |
201-741-4 |
Struktur Molekul |
|
Titik lebur |
236-240℃ |
Titik didih |
449°C at 760 mmHg |
Titik nyala |
225.4°C |
Tekanan uap |
5.97E-10mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|