ChemNet > CAS > 26426-80-2 poli (isobutilena-alt-maleat anhidrida)
26426-80-2 poli (isobutilena-alt-maleat anhidrida)
Nama produk |
poli (isobutilena-alt-maleat anhidrida) |
Sinonim |
2,5-Furandione, polimer dengan 2-metil-1-propena; 2-Metil-1-propena, polimer dengan 2,5-furandion; Kopolimer isobutilena/MA; Polielektrolit 60; Anhidrida maleat, kopolimer isobutilena; furan-2,5-dione - 2-metilprop-1-ena (1: 1) |
Nama bahasa Inggris |
poly(isobutylene-alt-maleic anhydride);2,5-Furandione, polymer with 2-methyl-1-propene; 2-Methyl-1-propene, polymer with 2,5-furandione; Isobutylene/MA copolymer; Polyelectrolyte 60; Maleic anhydride, isobutylene copolymer; furan-2,5-dione - 2-methylprop-1-ene (1:1) |
MF |
C8H10O3 |
Berat Molekul |
154.1632 |
InChI |
InChI=1/C4H2O3.C4H8/c5-3-1-2-4(6)7-3;1-4(2)3/h1-2H;1H2,2-3H3 |
CAS NO |
26426-80-2 |
Struktur Molekul |
|
Titik didih |
202°C at 760 mmHg |
Titik nyala |
103.3°C |
Tekanan uap |
0.299mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
|
|