26547-51-3 8-Phenyloctanoic acid

Nama produk	8-Phenyloctanoic acid
Nama bahasa Inggris	8-Phenyloctanoic acid; 8-phenyloctanoate; 8-Phenyl-1-octanoic acid
MF	C₁₄H₁₉O₂
Berat Molekul	219.3
InChI	InChI=1/C14H20O2/c15-14(16)12-8-3-1-2-5-9-13-10-6-4-7-11-13/h4,6-7,10-11H,1-3,5,8-9,12H2,(H,15,16)/p-1
CAS NO	26547-51-3
Struktur Molekul
Titik didih	369.9°C at 760 mmHg
Titik nyala	266.9°C
Tekanan uap	3.98E-06mmHg at 25°C
Simbol bahaya
Kode Risiko	R36/38:Irritating to eyes and skin.;
Keselamatan Deskripsi	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;