ChemNet > CAS > 2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
2672-58-4 Trimethyl 1,3,5-benzenetricarboxylate
Nama produk |
Trimethyl 1,3,5-benzenetricarboxylate |
Nama bahasa Inggris |
Trimethyl 1,3,5-benzenetricarboxylate; Trimethyl benzene-1,3,5-tricarboxylate; Trimethyl Trimesate; 1,3,5-Benzenetricarboxylic acid trimethyl ester; benzene-1,3,5-triyl triacetate; trimethyl cyclohexane-1,3,5-tricarboxylate |
MF |
C12H18O6 |
Berat Molekul |
258.2677 |
InChI |
InChI=1/C12H18O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h7-9H,4-6H2,1-3H3 |
CAS NO |
2672-58-4 |
EINECS |
220-215-5 |
Struktur Molekul |
|
Kepadatan |
1.177g/cm3 |
Titik lebur |
144-147℃ |
Titik didih |
332.8°C at 760 mmHg |
Indeks bias |
1.464 |
Titik nyala |
144.1°C |
Tekanan uap |
0.000142mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|