ChemNet > CAS > 26782-74-1 (S)-2-chloro-3-methylbutyric acid
26782-74-1 (S)-2-chloro-3-methylbutyric acid
Nama produk |
(S)-2-chloro-3-methylbutyric acid |
Nama bahasa Inggris |
(S)-2-chloro-3-methylbutyric acid; (S)-(-)-2-Chloro-3-methylbutyric acid; S-2-chloro-3-methylbutyric acid; (2S)-2-chloro-3-methylbutanoic acid |
MF |
C5H9ClO2 |
Berat Molekul |
136.5768 |
InChI |
InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
CAS NO |
26782-74-1 |
Struktur Molekul |
|
Kepadatan |
1.159g/cm3 |
Titik didih |
210.3°C at 760 mmHg |
Indeks bias |
1.447 |
Titik nyala |
81°C |
Tekanan uap |
0.0768mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|