ChemNet > CAS > 2694-54-4 Triallyl Trimellitate
2694-54-4 Triallyl Trimellitate
| Nama produk |
Triallyl Trimellitate |
| Nama bahasa Inggris |
Triallyl Trimellitate; 1,2,4-Benzenetricarboxylic acid triallyl ester; Trimellitic acid triallyl ester; triprop-2-en-1-yl benzene-1,2,4-tricarboxylate |
| MF |
C18H18O6 |
| Berat Molekul |
330.3319 |
| InChI |
InChI=1/C18H18O6/c1-4-9-22-16(19)13-7-8-14(17(20)23-10-5-2)15(12-13)18(21)24-11-6-3/h4-8,12H,1-3,9-11H2 |
| CAS NO |
2694-54-4 |
| EINECS |
220-264-2 |
| Struktur Molekul |
|
| Kepadatan |
1.149g/cm3 |
| Titik didih |
438.1°C at 760 mmHg |
| Indeks bias |
1.528 |
| Titik nyala |
191.3°C |
| Tekanan uap |
7.07E-08mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
