2905-56-8 1-Benzylpiperidine
Nama produk |
1-Benzylpiperidine |
Nama bahasa Inggris |
1-Benzylpiperidine; N-benzylpiperidine; 1-benzylpiperidine hydrochloride (1:1) |
MF |
C12H18ClN |
Berat Molekul |
211.731 |
InChI |
InChI=1/C12H17N.ClH/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1,3-4,7-8H,2,5-6,9-11H2;1H |
CAS NO |
2905-56-8 |
EINECS |
220-809-4 |
Struktur Molekul |
|
Titik didih |
246.6°C at 760 mmHg |
Titik nyala |
94°C |
Tekanan uap |
0.0269mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|