ChemNet > CAS > 2912-62-1 DL-2-Chloro-2-fenilasetil klorida
2912-62-1 DL-2-Chloro-2-fenilasetil klorida
Nama produk |
DL-2-Chloro-2-fenilasetil klorida |
Sinonim |
Klor(fenil)asetil klorida; CCRIS 8624; (2S)-kloro(fenil)etanoil klorida; (2R)-kloro(fenil)etanoil klorida |
Nama bahasa Inggris |
DL-2-Chloro-2-phenylacetyl chloride;Chloro(phenyl)acetyl chloride; CCRIS 8624; (2S)-chloro(phenyl)ethanoyl chloride; (2R)-chloro(phenyl)ethanoyl chloride |
MF |
C8H6Cl2O |
Berat Molekul |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1 |
CAS NO |
2912-62-1 |
EINECS |
220-826-7 |
Struktur Molekul |
|
Kepadatan |
1.322g/cm3 |
Titik didih |
228°C at 760 mmHg |
Indeks bias |
1.55 |
Titik nyala |
104.4°C |
Tekanan uap |
0.0753mmHg at 25°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Keselamatan Deskripsi |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|