ChemNet > CAS > 300665-23-0 (4-morfolino-3-nitrofenil)metanol hidroklorida
300665-23-0 (4-morfolino-3-nitrofenil)metanol hidroklorida
| Nama produk |
(4-morfolino-3-nitrofenil)metanol hidroklorida |
| Sinonim |
(4-morfolin-4-il-3-nitrofenil)metanol hidroklorida |
| Nama bahasa Inggris |
(4-morpholino-3-nitrophenyl)methanol hydrochloride;(4-morpholin-4-yl-3-nitrophenyl)methanol hydrochloride |
| MF |
C11H15ClN2O4 |
| Berat Molekul |
274.7008 |
| InChI |
InChI=1/C11H14N2O4.ClH/c14-8-9-1-2-10(11(7-9)13(15)16)12-3-5-17-6-4-12;/h1-2,7,14H,3-6,8H2;1H |
| CAS NO |
300665-23-0 |
| Struktur Molekul |
|
| Titik lebur |
107℃ |
| Titik didih |
468.5°C at 760 mmHg |
| Titik nyala |
237.2°C |
| Tekanan uap |
1.4E-09mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|