3034-19-3 2-Nitrophenylhydrazine
Nama produk |
2-Nitrophenylhydrazine |
Nama bahasa Inggris |
2-Nitrophenylhydrazine; BRN 0512797; Hydrazine, (o-nitrophenyl)- |
MF |
C6H7N3O2 |
Berat Molekul |
153.1387 |
InChI |
InChI=1/C6H7N3O2/c7-8-5-3-1-2-4-6(5)9(10)11/h1-4,8H,7H2 |
CAS NO |
3034-19-3 |
EINECS |
221-222-6 |
Struktur Molekul |
|
Kepadatan |
1.419g/cm3 |
Titik lebur |
89-94℃ |
Titik didih |
314.3°C at 760 mmHg |
Indeks bias |
1.691 |
Titik nyala |
143.9°C |
Tekanan uap |
0.000469mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R5:Heating may cause an explosion.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|