ChemNet > CAS > 305-15-7 2,5-Dichlorophenylhydrazine
305-15-7 2,5-Dichlorophenylhydrazine
Nama produk |
2,5-Dichlorophenylhydrazine |
Nama bahasa Inggris |
2,5-Dichlorophenylhydrazine ; -2,5-DICHLOROPHENYLHYDRAZINE; 1-(2,5-DICHLOROPHENYL)HYDRAZINE; (2,5-dichlorophenyl)-hydrazin; Hydrazine, (2,5-dichlorophenyl)-; 2,5-DICHLOROPHENYLHYRAZINE |
MF |
C6H6Cl2N2 |
Berat Molekul |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
CAS NO |
305-15-7 |
EINECS |
206-163-6 |
Struktur Molekul |
|
Kepadatan |
1.475g/cm3 |
Titik lebur |
100-104℃ |
Titik didih |
266.8°C at 760 mmHg |
Indeks bias |
1.665 |
Titik nyala |
115.1°C |
Tekanan uap |
0.00848mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|