30544-34-4 2,3-Dibromofuran
Nama produk |
2,3-Dibromofuran |
Nama bahasa Inggris |
2,3-Dibromofuran; |
MF |
C4H2Br2O |
Berat Molekul |
225.8661 |
InChI |
InChI=1/C4H2Br2O/c5-3-1-2-7-4(3)6/h1-2H |
CAS NO |
30544-34-4 |
Struktur Molekul |
|
Kepadatan |
2.159g/cm3 |
Titik didih |
175.6°C at 760 mmHg |
Indeks bias |
1.562 |
Titik nyala |
60°C |
Tekanan uap |
1.53mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|