ChemNet > CAS > 3088-42-4 N-(2-Cyanoethyl)glycine
3088-42-4 N-(2-Cyanoethyl)glycine
| Nama produk |
N-(2-Cyanoethyl)glycine |
| Nama bahasa Inggris |
N-(2-Cyanoethyl)glycine; N-(2-Cyanoehtyl)glycine |
| MF |
C5H8N2O2 |
| Berat Molekul |
128.1292 |
| InChI |
InChI=1/C5H8N2O2/c6-2-1-3-7-4-5(8)9/h7H,1,3-4H2,(H,8,9) |
| CAS NO |
3088-42-4 |
| EINECS |
221-418-1 |
| Struktur Molekul |
|
| Kepadatan |
1.187g/cm3 |
| Titik lebur |
188-193℃ |
| Titik didih |
343.1°C at 760 mmHg |
| Indeks bias |
1.473 |
| Titik nyala |
161.3°C |
| Tekanan uap |
1.3E-05mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
