ChemNet > CAS > 30934-97-5 Glycolaldehyde dimethyl acetal
30934-97-5 Glycolaldehyde dimethyl acetal
| Nama produk |
Glycolaldehyde dimethyl acetal |
| Nama bahasa Inggris |
Glycolaldehyde dimethyl acetal; 2,2-Dimethoxyethanol~Hydroxyacetaldehyde dimethyl acetal; 2,2-Dimethoxyethanol; 2,3-dimethoxy ethanol |
| MF |
C4H10O3 |
| Berat Molekul |
106.1204 |
| InChI |
InChI=1/C4H10O3/c1-6-4(3-5)7-2/h4-5H,3H2,1-2H3 |
| CAS NO |
30934-97-5 |
| EINECS |
250-398-7 |
| Struktur Molekul |
|
| Kepadatan |
1.009g/cm3 |
| Titik didih |
146.1°C at 760 mmHg |
| Indeks bias |
1.401 |
| Titik nyala |
42.2°C |
| Tekanan uap |
1.85mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
