ChemNet > CAS > 32022-38-1 2-Methyl-4-chlorophenoxyacetic acid hydrazide
32022-38-1 2-Methyl-4-chlorophenoxyacetic acid hydrazide
Nama produk |
2-Methyl-4-chlorophenoxyacetic acid hydrazide |
Nama bahasa Inggris |
2-Methyl-4-chlorophenoxyacetic acid hydrazide; AKOS BBB/133; AKOS BBS-00001030; (4-CHLORO-2-METHYL-PHENOXY)-ACETIC ACID HYDRAZIDE; 2-(4-CHLORO-2-METHYLPHENOXY)ACETIC ACID HYDRAZIDE; 2-(4-CHLORO-O-TOLYLOXY)ACETIC ACID HYDRAZIDE; 2-(4-chloro-2-methylphenoxy)acetohydrazide |
MF |
C9H11ClN2O2 |
Berat Molekul |
214.6488 |
InChI |
InChI=1/C9H11ClN2O2/c1-6-4-7(10)2-3-8(6)14-5-9(13)12-11/h2-4H,5,11H2,1H3,(H,12,13) |
CAS NO |
32022-38-1 |
Struktur Molekul |
|
Kepadatan |
1.279g/cm3 |
Titik didih |
427.5°C at 760 mmHg |
Indeks bias |
1.562 |
Titik nyala |
212.4°C |
Tekanan uap |
1.63E-07mmHg at 25°C |
Simbol bahaya |
Xi:刺激性物质;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|