ChemNet > CAS > 3282-11-9 4,4''-Dinitro-p-terphenyl
3282-11-9 4,4''-Dinitro-p-terphenyl
Nama produk |
4,4''-Dinitro-p-terphenyl |
Nama bahasa Inggris |
4,4''-Dinitro-p-terphenyl;p-Terphenyl, 4,4''-dinitro-; 4,4''-dinitro-1,1':4',1''-terphenyl |
MF |
C18H12N2O4 |
Berat Molekul |
320.2989 |
InChI |
InChI=1/C18H12N2O4/c21-19(22)17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(12-8-16)20(23)24/h1-12H |
CAS NO |
3282-11-9 |
Struktur Molekul |
|
Kepadatan |
1.314g/cm3 |
Titik didih |
534.4°C at 760 mmHg |
Indeks bias |
1.646 |
Titik nyala |
260.2°C |
Tekanan uap |
5.85E-11mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R20/22:Harmful by inhalation and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|