ChemNet > CAS > 32852-81-6 3-Phenoxyphenylacetic acid
32852-81-6 3-Phenoxyphenylacetic acid
Nama produk |
3-Phenoxyphenylacetic acid |
Nama bahasa Inggris |
3-Phenoxyphenylacetic acid; 3-Phenoxyphenylacetic |
MF |
C14H12O3 |
Berat Molekul |
228.2433 |
InChI |
InChI=1/C14H12O3/c15-14(16)10-11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9H,10H2,(H,15,16) |
CAS NO |
32852-81-6 |
Struktur Molekul |
|
Kepadatan |
1.217g/cm3 |
Titik didih |
385.4°C at 760 mmHg |
Indeks bias |
1.596 |
Titik nyala |
147.4°C |
Tekanan uap |
1.25E-06mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|