ChemNet > CAS > 3289-28-9 Ethyl Cyclohexanecarboxylate
3289-28-9 Ethyl Cyclohexanecarboxylate
Nama produk |
Ethyl Cyclohexanecarboxylate |
Nama bahasa Inggris |
Ethyl Cyclohexanecarboxylate; Cyclohexanecarboxylic acid ethyl ester; Ethyl cyclohexane carboxylate |
MF |
C9H16O2 |
Berat Molekul |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-2-11-9(10)8-6-4-3-5-7-8/h8H,2-7H2,1H3 |
CAS NO |
3289-28-9 |
EINECS |
221-945-7 |
Struktur Molekul |
|
Kepadatan |
0.972g/cm3 |
Titik didih |
197.1°C at 760 mmHg |
Indeks bias |
1.451 |
Titik nyala |
68.5°C |
Tekanan uap |
0.385mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|