33733-73-2 3-Bromothioanisole

Nama produk	3-Bromothioanisole
Nama bahasa Inggris	3-Bromothioanisole; 3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene
MF	C₇H₇BrOS
Berat Molekul	219.0989
InChI	InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3
CAS NO	33733-73-2
Struktur Molekul
Kepadatan	1.567g/cm³
Titik didih	278.106°C at 760 mmHg
Indeks bias	1.616
Titik nyala	121.995°C
Tekanan uap	0.007mmHg at 25°C
Simbol bahaya
Kode Risiko	R36/38:Irritating to eyes and skin.;
Keselamatan Deskripsi	S23:; S24/25:;