ChemNet > CAS > 3445-84-9 N, N-Bis (2-sianoetil) formamida
3445-84-9 N, N-Bis (2-sianoetil) formamida
| Nama produk |
N, N-Bis (2-sianoetil) formamida |
| Sinonim |
; 3,3- (Formylimino)dipropionitril; NN-Bis (2-sianoetil) formamida, Praktek. |
| Nama bahasa Inggris |
N,N-Bis(2-cyanoethyl)formamide; 3,3-(Formylimino)dipropionitrile; NN-Bis(2-cyanoethyl)formamide, Pract. |
| MF |
C7H9N3O |
| Berat Molekul |
151.1659 |
| InChI |
InChI=1/C7H9N3O/c8-3-1-5-10(7-11)6-2-4-9/h7H,1-2,5-6H2 |
| CAS NO |
3445-84-9 |
| EINECS |
222-362-0 |
| Struktur Molekul |
|
| Kepadatan |
1.116g/cm3 |
| Titik didih |
444.1°C at 760 mmHg |
| Indeks bias |
1.476 |
| Titik nyala |
222.4°C |
| Tekanan uap |
4.39E-08mmHg at 25°C |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|