3468-17-5 6-(Aminomethyl)indole
Nama produk |
6-(Aminomethyl)indole |
Nama bahasa Inggris |
6-(Aminomethyl)indole; INDOLE-6-METHYLAMINE; 1H-INDOLE-6-METHANAMINE; ; 1-(1H-indol-6-yl)methanamine |
MF |
C9H10N2 |
Berat Molekul |
146.1891 |
InChI |
InChI=1/C9H10N2/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5,11H,6,10H2 |
CAS NO |
3468-17-5 |
Struktur Molekul |
|
Kepadatan |
1.2g/cm3 |
Titik didih |
335.599°C at 760 mmHg |
Indeks bias |
1.698 |
Titik nyala |
183.277°C |
Tekanan uap |
0mmHg at 25°C |
Simbol bahaya |
Xi:;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|