ChemNet > CAS > 3468-17-5 6-(Aminomethyl)indole
3468-17-5 6-(Aminomethyl)indole
| Nama produk |
6-(Aminomethyl)indole |
| Nama bahasa Inggris |
6-(Aminomethyl)indole; INDOLE-6-METHYLAMINE; 1H-INDOLE-6-METHANAMINE; ; 1-(1H-indol-6-yl)methanamine |
| MF |
C9H10N2 |
| Berat Molekul |
146.1891 |
| InChI |
InChI=1/C9H10N2/c10-6-7-1-2-8-3-4-11-9(8)5-7/h1-5,11H,6,10H2 |
| CAS NO |
3468-17-5 |
| Struktur Molekul |
|
| Kepadatan |
1.2g/cm3 |
| Titik didih |
335.599°C at 760 mmHg |
| Indeks bias |
1.698 |
| Titik nyala |
183.277°C |
| Tekanan uap |
0mmHg at 25°C |
| Simbol bahaya |
 Xi:;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
