3468-53-9 Phenyl nicotinate
Nama produk |
Phenyl nicotinate |
Nama bahasa Inggris |
Phenyl nicotinate; Phenyl nicotinate, (Nicotinic acid phenyl ester; Nicotinic acid phenyl ester~Phenyl pyridine-3-carboxylate; phenyl pyridine-3-carboxylate |
MF |
C12H9NO2 |
Berat Molekul |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-12(10-5-4-8-13-9-10)15-11-6-2-1-3-7-11/h1-9H |
CAS NO |
3468-53-9 |
EINECS |
222-428-9 |
Struktur Molekul |
|
Kepadatan |
1.199g/cm3 |
Titik lebur |
70-72℃ |
Titik didih |
338.9°C at 760 mmHg |
Indeks bias |
1.589 |
Titik nyala |
158.8°C |
Tekanan uap |
9.51E-05mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
Keselamatan Deskripsi |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|