3512-18-3 2,3,6-Trifluoropyridine
Nama produk |
2,3,6-Trifluoropyridine |
Nama bahasa Inggris |
2,3,6-Trifluoropyridine; |
MF |
C5H2F3N |
Berat Molekul |
133.0713 |
InChI |
InChI=1/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
CAS NO |
3512-18-3 |
Struktur Molekul |
|
Kepadatan |
1.396g/cm3 |
Titik didih |
123.7°C at 760 mmHg |
Indeks bias |
1.424 |
Titik nyala |
28.6°C |
Tekanan uap |
15.9mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|