ChemNet > CAS > 3512-18-3 2,3,6-Trifluoropyridine
3512-18-3 2,3,6-Trifluoropyridine
| Nama produk |
2,3,6-Trifluoropyridine |
| Nama bahasa Inggris |
2,3,6-Trifluoropyridine; |
| MF |
C5H2F3N |
| Berat Molekul |
133.0713 |
| InChI |
InChI=1/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| CAS NO |
3512-18-3 |
| Struktur Molekul |
|
| Kepadatan |
1.396g/cm3 |
| Titik didih |
123.7°C at 760 mmHg |
| Indeks bias |
1.424 |
| Titik nyala |
28.6°C |
| Tekanan uap |
15.9mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
