ChemNet > CAS > 35553-92-5 ethyl 2-(3-methoxyphenyl)acetate
35553-92-5 ethyl 2-(3-methoxyphenyl)acetate
Nama produk |
ethyl 2-(3-methoxyphenyl)acetate |
Nama bahasa Inggris |
ethyl 2-(3-methoxyphenyl)acetate; Ethyl 3-methoxyphenylacetate |
MF |
C11H14O3 |
Berat Molekul |
194.2271 |
InChI |
InChI=1/C11H14O3/c1-3-14-11(12)8-9-5-4-6-10(7-9)13-2/h4-7H,3,8H2,1-2H3 |
CAS NO |
35553-92-5 |
EINECS |
252-614-5 |
Struktur Molekul |
|
Kepadatan |
1.062g/cm3 |
Titik didih |
271.6°C at 760 mmHg |
Indeks bias |
1.497 |
Titik nyala |
108.5°C |
Tekanan uap |
0.00637mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|