ChemNet > CAS > 35884-42-5 di(propylene glycol) butyl ether, mixture of
35884-42-5 di(propylene glycol) butyl ether, mixture of
| Nama produk |
di(propylene glycol) butyl ether, mixture of |
| Nama bahasa Inggris |
di(propylene glycol) butyl ether, mixture of; Di(propylene glycol) butyl ether,mixture of isomers; 1-(3-butoxypropoxy)propan-1-ol; Dipropylene glycol butyl ether |
| MF |
C10H22O3 |
| Berat Molekul |
190.2799 |
| InChI |
InChI=1/C10H22O3/c1-3-5-7-12-8-6-9-13-10(11)4-2/h10-11H,3-9H2,1-2H3 |
| CAS NO |
35884-42-5 |
| EINECS |
252-776-7 |
| Struktur Molekul |
|
| Kepadatan |
0.931g/cm3 |
| Titik didih |
221.1°C at 760 mmHg |
| Indeks bias |
1.435 |
| Titik nyala |
87.5°C |
| Tekanan uap |
0.0226mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
|
|
