ChemNet > CAS > 36436-65-4 2'-Hydroxy-4',5'-dimethylacetophenone
36436-65-4 2'-Hydroxy-4',5'-dimethylacetophenone
| Nama produk |
2'-Hydroxy-4',5'-dimethylacetophenone |
| Nama bahasa Inggris |
2'-Hydroxy-4',5'-dimethylacetophenone;1-(2-hydroxy-4,5-dimethylphenyl)ethanone |
| MF |
C10H12O2 |
| Berat Molekul |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-6-4-9(8(3)11)10(12)5-7(6)2/h4-5,12H,1-3H3 |
| CAS NO |
36436-65-4 |
| EINECS |
253-035-0 |
| Struktur Molekul |
|
| Kepadatan |
1.08g/cm3 |
| Titik lebur |
69-73℃ |
| Titik didih |
274.3°C at 760 mmHg |
| Indeks bias |
1.541 |
| Titik nyala |
114.6°C |
| Tekanan uap |
0.00324mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
