ChemNet > CAS > 368870-06-8 1- (4-klorofenetil) -5-okso-3-asam pirolidinakarboksilat
368870-06-8 1- (4-klorofenetil) -5-okso-3-asam pirolidinakarboksilat
| Nama produk |
1- (4-klorofenetil) -5-okso-3-asam pirolidinakarboksilat |
| Sinonim |
1-[2-(4-klorofenil)etil]-5-oksopirolidin-3-asam karboksilat |
| Nama bahasa Inggris |
1-(4-chlorophenethyl)-5-oxo-3-pyrrolidinecarboxylic acid;1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| MF |
C13H14ClNO3 |
| Berat Molekul |
267.7082 |
| InChI |
InChI=1/C13H14ClNO3/c14-11-3-1-9(2-4-11)5-6-15-8-10(13(17)18)7-12(15)16/h1-4,10H,5-8H2,(H,17,18) |
| CAS NO |
368870-06-8 |
| Struktur Molekul |
|
| Kepadatan |
1.346g/cm3 |
| Titik lebur |
148℃ |
| Titik didih |
496.6°C at 760 mmHg |
| Indeks bias |
1.588 |
| Titik nyala |
254.1°C |
| Tekanan uap |
1.11E-10mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|