374537-99-2 7-Amino-5-bromoindole
Nama produk |
7-Amino-5-bromoindole |
Nama bahasa Inggris |
7-Amino-5-bromoindole; 5-Bromo-7-indolamine; 5-bromo-1H-indol-7-amine |
MF |
C8H7BrN2 |
Berat Molekul |
211.0586 |
InChI |
InChI=1/C8H7BrN2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H,10H2 |
CAS NO |
374537-99-2 |
Struktur Molekul |
|
Kepadatan |
1.753g/cm3 |
Titik didih |
405.6°C at 760 mmHg |
Indeks bias |
1.779 |
Titik nyala |
199.1°C |
Tekanan uap |
8.68E-07mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|