ChemNet > CAS > 38071-22-6 4,5-Dibromothiophene-2-carboxaldehyde
38071-22-6 4,5-Dibromothiophene-2-carboxaldehyde
Nama produk |
4,5-Dibromothiophene-2-carboxaldehyde |
Nama bahasa Inggris |
4,5-Dibromothiophene-2-carboxaldehyde;4,5-dibromothiophene-2-carbaldehyde |
MF |
C5H2Br2OS |
Berat Molekul |
269.9418 |
InChI |
InChI=1/C5H2Br2OS/c6-4-1-3(2-8)9-5(4)7/h1-2H |
CAS NO |
38071-22-6 |
Struktur Molekul |
|
Kepadatan |
2.195g/cm3 |
Titik lebur |
79℃ |
Titik didih |
306.1°C at 760 mmHg |
Indeks bias |
1.685 |
Titik nyala |
138.9°C |
Tekanan uap |
0.00079mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|