38460-95-6 10-Undecenoyl chloride

Nama produk	10-Undecenoyl chloride
Nama bahasa Inggris	10-Undecenoyl chloride; Undecenoylchloride; ; 10-Undeconyl chloride
MF	C₁₁H₁₉ClO
Berat Molekul	202.72
InChI	InChI=1/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2
CAS NO	38460-95-6
EINECS	253-951-0
Struktur Molekul
Kepadatan	0.94
Titik didih	120-122℃ (10 torr)
Indeks bias	1.4532-1.4552
Titik nyala	93℃
Simbol bahaya	C:Corrosive;
Kode Risiko	R34:Causes burns.;
Keselamatan Deskripsi	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;