ChemNet > CAS > 38690-76-5 4-Sianofenil 4-heptylbenzoate
38690-76-5 4-Sianofenil 4-heptylbenzoate
| Nama produk |
4-Sianofenil 4-heptylbenzoate |
| Sinonim |
; 4-n-Asam heptylbenzoic 4-Cyanophenyl ester |
| Nama bahasa Inggris |
4-Cyanophenyl 4-heptylbenzoate; 4-n-Heptylbenzoic acid 4-Cyanophenyl ester |
| MF |
C21H23NO2 |
| Berat Molekul |
321.4128 |
| InChI |
InChI=1/C21H23NO2/c1-2-3-4-5-6-7-17-8-12-19(13-9-17)21(23)24-20-14-10-18(16-22)11-15-20/h8-15H,2-7H2,1H3 |
| CAS NO |
38690-76-5 |
| EINECS |
254-084-0 |
| Struktur Molekul |
|
| Kepadatan |
1.09g/cm3 |
| Titik lebur |
43-45℃ |
| Titik didih |
476.4°C at 760 mmHg |
| Indeks bias |
1.56 |
| Titik nyala |
238.3°C |
| Tekanan uap |
3.07E-09mmHg at 25°C |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|