ChemNet > CAS > 39101-54-7 3,5-Dimethylphenylacetonitrile
39101-54-7 3,5-Dimethylphenylacetonitrile
| Nama produk |
3,5-Dimethylphenylacetonitrile |
| Nama bahasa Inggris |
3,5-Dimethylphenylacetonitrile; 3,5-Dimethylbenzyl cyanide; 2-(3,5-Dimethylphenyl)acetonitrile |
| MF |
C10H11N |
| Berat Molekul |
145.201 |
| InChI |
InChI=1/C10H11N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3H2,1-2H3 |
| CAS NO |
39101-54-7 |
| EINECS |
254-292-1 |
| Struktur Molekul |
|
| Kepadatan |
0.979g/cm3 |
| Titik didih |
254.5°C at 760 mmHg |
| Indeks bias |
1.524 |
| Titik nyala |
117.5°C |
| Tekanan uap |
0.0172mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|
