ChemNet > CAS > 39769-09-0 4,4'-Difluorobenzylideneaniline
39769-09-0 4,4'-Difluorobenzylideneaniline
Nama produk |
4,4'-Difluorobenzylideneaniline |
Nama bahasa Inggris |
4,4'-Difluorobenzylideneaniline;4-fluoro-N-[(1E)-(4-fluorophenyl)methylidene]aniline |
MF |
C13H9F2N |
Berat Molekul |
217.2141 |
InChI |
InChI=1/C13H9F2N/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-9H/b16-9+ |
CAS NO |
39769-09-0 |
Struktur Molekul |
|
Kepadatan |
1.11g/cm3 |
Titik lebur |
64℃ |
Titik didih |
307.4°C at 760 mmHg |
Indeks bias |
1.527 |
Titik nyala |
139.7°C |
Tekanan uap |
0.00132mmHg at 25°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|