ChemNet > CAS > 3988-03-2 4,4'-dibromobenzophenone
3988-03-2 4,4'-dibromobenzophenone
| Nama produk |
4,4'-dibromobenzophenone |
| Nama bahasa Inggris |
4,4'-dibromobenzophenone; Bis(p-bromophenyl) ketone; NSC 86518; p,p'-Dibromobenzophenone; Benzophenone, 4,4'-dibromo- (8CI); Methanone, bis(4-bromophenyl)- (9CI); bis(4-bromophenyl)methanone |
| MF |
C13H8Br2O |
| Berat Molekul |
340.01 |
| InChI |
InChI=1/C13H8Br2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
| CAS NO |
3988-03-2 |
| EINECS |
223-632-0 |
| Struktur Molekul |
|
| Kepadatan |
1.7g/cm3 |
| Titik lebur |
171-174℃ |
| Titik didih |
395.6°C at 760 mmHg |
| Indeks bias |
1.633 |
| Titik nyala |
121°C |
| Tekanan uap |
1.82E-06mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S22:;
S24/25:;
|
|
