ChemNet > CAS > 39910-98-0 4-Morpholinoacetophenone
39910-98-0 4-Morpholinoacetophenone
| Nama produk |
4-Morpholinoacetophenone |
| Nama bahasa Inggris |
4-Morpholinoacetophenone; Acetophenone, 4'-morpholino-; BRN 1214737; p-Morpholinoacetophenone; 1-[4-(morpholin-4-yl)phenyl]ethanone |
| MF |
C12H15NO2 |
| Berat Molekul |
205.253 |
| InChI |
InChI=1/C12H15NO2/c1-10(14)11-2-4-12(5-3-11)13-6-8-15-9-7-13/h2-5H,6-9H2,1H3 |
| CAS NO |
39910-98-0 |
| EINECS |
254-698-9 |
| Struktur Molekul |
|
| Kepadatan |
1.113g/cm3 |
| Titik lebur |
94-98℃ |
| Titik didih |
376.7°C at 760 mmHg |
| Indeks bias |
1.543 |
| Titik nyala |
181.6°C |
| Tekanan uap |
7.13E-06mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
