ChemNet > CAS > 4151-80-8 4,4'-Biphenyldiboronic acid
4151-80-8 4,4'-Biphenyldiboronic acid
Nama produk |
4,4'-Biphenyldiboronic acid |
Nama bahasa Inggris |
4,4'-Biphenyldiboronic acid;biphenyl-4,4'-diyldiboronic acid |
MF |
C12H12B2O4 |
Berat Molekul |
241.8433 |
InChI |
InChI=1/C12H12B2O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8,15-18H |
CAS NO |
4151-80-8 |
Struktur Molekul |
|
Kepadatan |
1.31g/cm3 |
Titik lebur |
300℃ (dec.) |
Titik didih |
505.9°C at 760 mmHg |
Indeks bias |
1.62 |
Titik nyala |
259.7°C |
Tekanan uap |
4.69E-11mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|