ChemNet > CAS > 4184-79-6 5,6-Dimethyl-1H-benzotriazole hydrate
4184-79-6 5,6-Dimethyl-1H-benzotriazole hydrate
Nama produk |
5,6-Dimethyl-1H-benzotriazole hydrate |
Nama bahasa Inggris |
5,6-Dimethyl-1H-benzotriazole hydrate; 5,6-Dimethylbenzotriazole monohydrate; 5,6-dimethyl-2H-benzotriazole |
MF |
C8H9N3 |
Berat Molekul |
147.1772 |
InChI |
InChI=1/C8H9N3/c1-5-3-7-8(4-6(5)2)10-11-9-7/h3-4H,1-2H3,(H,9,10,11) |
CAS NO |
4184-79-6 |
EINECS |
224-058-3 |
Struktur Molekul |
|
Kepadatan |
1.217g/cm3 |
Titik lebur |
153-156℃ |
Titik didih |
309.7°C at 760 mmHg |
Indeks bias |
1.655 |
Titik nyala |
145.6°C |
Tekanan uap |
0.000628mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|