ChemNet > CAS > 42087-80-9 metil 4-kloro-2-nitrobenzoat
42087-80-9 metil 4-kloro-2-nitrobenzoat
Nama produk |
metil 4-kloro-2-nitrobenzoat |
Sinonim |
; 4-Chloro-2-nitrobenzoic acid methyl ester |
Nama bahasa Inggris |
Methyl 4-Chloro-2-Nitrobenzoate; 4-Chloro-2-nitrobenzoic acid methyl ester |
MF |
C8H6ClNO4 |
Berat Molekul |
215.5905 |
InChI |
InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(9)4-7(6)10(12)13/h2-4H,1H3 |
CAS NO |
42087-80-9 |
EINECS |
255-654-1 |
Struktur Molekul |
|
Kepadatan |
1.426g/cm3 |
Titik lebur |
43-45℃ |
Titik didih |
285.6°C at 760 mmHg |
Indeks bias |
1.568 |
Titik nyala |
126.5°C |
Tekanan uap |
0.00277mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|