ChemNet > CAS > 4286-15-1 S(+)-2-phenylbutyric acid
4286-15-1 S(+)-2-phenylbutyric acid
Nama produk |
S(+)-2-phenylbutyric acid |
Nama bahasa Inggris |
S(+)-2-phenylbutyric acid; (S)-(+)-2-Phenylbutyric acid; (S)-(+)-alpha-Ethylphenylacetic acid; (2S)-2-phenylbutanoic acid |
MF |
C10H12O2 |
Berat Molekul |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12)/t9-/m0/s1 |
CAS NO |
4286-15-1 |
EINECS |
201-982-5 |
Struktur Molekul |
|
Kepadatan |
1.09g/cm3 |
Titik didih |
272.9°C at 760 mmHg |
Indeks bias |
1.531 |
Titik nyala |
170.2°C |
Tekanan uap |
0.00288mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|