ChemNet > CAS > 43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
| Nama produk |
Ethyl 2-amino-4-methylthiophene-3-carboxylate |
| Nama bahasa Inggris |
Ethyl 2-amino-4-methylthiophene-3-carboxylate; 2-Amino-4-methylthiophene-3-carboxylic acid ethyl ester |
| MF |
C8H11NO2S |
| Berat Molekul |
185.2434 |
| InChI |
InChI=1/C8H11NO2S/c1-3-11-8(10)6-5(2)4-12-7(6)9/h4H,3,9H2,1-2H3 |
| CAS NO |
43088-42-2 |
| Struktur Molekul |
|
| Kepadatan |
1.219g/cm3 |
| Titik lebur |
72℃ |
| Titik didih |
279.1°C at 760 mmHg |
| Indeks bias |
1.573 |
| Titik nyala |
122.6°C |
| Tekanan uap |
0.00411mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
