ChemNet > CAS > 4441-01-4 1,2,4-Triphenyl-1,4-butanedione
4441-01-4 1,2,4-Triphenyl-1,4-butanedione
Nama produk |
1,2,4-Triphenyl-1,4-butanedione |
Nama bahasa Inggris |
1,2,4-Triphenyl-1,4-butanedione;1,4-Butanedione, 1,2,4-triphenyl-; AI3-17642; NSC 7759; 1,2,4-triphenylbutane-1,4-dione; (2S)-1,2,4-triphenylbutane-1,4-dione; (2R)-1,2,4-triphenylbutane-1,4-dione |
MF |
C22H18O2 |
Berat Molekul |
314.3771 |
InChI |
InChI=1/C22H18O2/c23-21(18-12-6-2-7-13-18)16-20(17-10-4-1-5-11-17)22(24)19-14-8-3-9-15-19/h1-15,20H,16H2/t20-/m1/s1 |
CAS NO |
4441-01-4 |
Struktur Molekul |
|
Kepadatan |
1.143g/cm3 |
Titik didih |
496.2°C at 760 mmHg |
Indeks bias |
1.607 |
Titik nyala |
183.6°C |
Tekanan uap |
5.52E-10mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|