ChemNet > CAS > 4472-41-7 N,N-Dimethylformamide-d7
4472-41-7 N,N-Dimethylformamide-d7
| Nama produk |
N,N-Dimethylformamide-d7 |
| Nama bahasa Inggris |
N,N-Dimethylformamide-d7; Dimethylformamidedisotopicpurity; N,N-bis[(~2~H_3_)methyl](~2~H)formamide; N,N-bis[(~2~H_3_)methyl]formamide |
| MF |
C3HD6NO |
| Berat Molekul |
79.1308 |
| InChI |
InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3 |
| CAS NO |
4472-41-7 |
| EINECS |
224-745-8 |
| Struktur Molekul |
|
| Kepadatan |
0.958g/cm3 |
| Titik didih |
152.999°C at 760 mmHg |
| Indeks bias |
1.396 |
| Titik nyala |
57.778°C |
| Tekanan uap |
3.403mmHg at 25°C |
| Simbol bahaya |
 T:Toxic;
|
| Kode Risiko |
R20/21:Harmful by inhalation and in contact with skin.;
R36:Irritating to eyes.;
R61:May cause harm to the unborn child.;
|
| Keselamatan Deskripsi |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
